C22H17FN4O3S — CID 36682472
5-(4-fluorophenyl)-N'-[2-(4-methyl-1-oxophthalazin-2-yl)acetyl]thiophene-2-carbohydrazide (PubChem CID 36682472) has the molecular formula C22H17FN4O3S and a molecular weight of 436.47 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-N'-[2-(4-methyl-1-oxophthalazin-2-yl)acetyl]thiophene-2-carbohydrazide.
| Compound Name | 5-(4-fluorophenyl)-N'-[2-(4-methyl-1-oxophthalazin-2-yl)acetyl]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 36682472 |
| Molecular Formula | C22H17FN4O3S |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | 5-(4-fluorophenyl)-N'-[2-(4-methyl-1-oxophthalazin-2-yl)acetyl]thiophene-2-carbohydrazide |
| SMILES | Cc1nn(CC(=O)NNC(=O)c2ccc(-c3ccc(F)cc3)s2)c(=O)c2ccccc12 |
| InChI | InChI=1S/C22H17FN4O3S/c1-13-16-4-2-3-5-17(16)22(30)27(26-13)12-20(28)24-25-21(29)19-11-10-18(31-19)14-6-8-15(23)9-7-14/h2-11H,12H2,1H3,(H,24,28)(H,25,29) |
| InChIKey | CWPINUDTXMAOQG-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|