C23H20FN5O2S2 — CID 24554183
5-(4-fluorophenyl)-N'-[3-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]propanoyl]thiophene-2-carbohydrazide (PubChem CID 24554183) has the molecular formula C23H20FN5O2S2 and a molecular weight of 481.58 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-N'-[3-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]propanoyl]thiophene-2-carbohydrazide.
| Compound Name | 5-(4-fluorophenyl)-N'-[3-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]propanoyl]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 24554183 |
| Molecular Formula | C23H20FN5O2S2 |
| Molecular Weight | 481.58 g/mol |
| Exact Mass | 481.10 |
| IUPAC Name | 5-(4-fluorophenyl)-N'-[3-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]propanoyl]thiophene-2-carbohydrazide |
| SMILES | Cc1ccc(-c2n[nH]c(=S)n2CCC(=O)NNC(=O)c2ccc(-c3ccc(F)cc3)s2)cc1 |
| InChI | InChI=1S/C23H20FN5O2S2/c1-14-2-4-16(5-3-14)21-26-28-23(32)29(21)13-12-20(30)25-27-22(31)19-11-10-18(33-19)15-6-8-17(24)9-7-15/h2-11H,12-13H2,1H3,(H,25,30)(H,27,31)(H,28,32) |
| InChIKey | KAHVWRAJHCNHFK-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 91.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.58 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|