C25H25FN6O2S — CID 24540790
1-(4-fluorophenyl)-2,5-dimethyl-N'-[3-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]propanoyl]pyrrole-3-carbohydrazide (PubChem CID 24540790) has the molecular formula C25H25FN6O2S and a molecular weight of 492.58 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-2,5-dimethyl-N'-[3-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]propanoyl]pyrrole-3-carbohydrazide.
| Compound Name | 1-(4-fluorophenyl)-2,5-dimethyl-N'-[3-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]propanoyl]pyrrole-3-carbohydrazide |
|---|---|
| PubChem CID | 24540790 |
| Molecular Formula | C25H25FN6O2S |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.17 |
| IUPAC Name | 1-(4-fluorophenyl)-2,5-dimethyl-N'-[3-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]propanoyl]pyrrole-3-carbohydrazide |
| SMILES | Cc1cccc(-c2n[nH]c(=S)n2CCC(=O)NNC(=O)c2cc(C)n(-c3ccc(F)cc3)c2C)c1 |
| InChI | InChI=1S/C25H25FN6O2S/c1-15-5-4-6-18(13-15)23-28-30-25(35)31(23)12-11-22(33)27-29-24(34)21-14-16(2)32(17(21)3)20-9-7-19(26)8-10-20/h4-10,13-14H,11-12H2,1-3H3,(H,27,33)(H,29,34)(H,30,35) |
| InChIKey | QXUJWPIJZXVNGF-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 96.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|