C17H17BrN6O2S — CID 31598696
4-bromo-N'-[3-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]propanoyl]-1H-pyrrole-2-carbohydrazide (PubChem CID 31598696) has the molecular formula C17H17BrN6O2S and a molecular weight of 449.33 g/mol. Its IUPAC name is 4-bromo-N'-[3-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]propanoyl]-1H-pyrrole-2-carbohydrazide.
| Compound Name | 4-bromo-N'-[3-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]propanoyl]-1H-pyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 31598696 |
| Molecular Formula | C17H17BrN6O2S |
| Molecular Weight | 449.33 g/mol |
| Exact Mass | 448.03 |
| IUPAC Name | 4-bromo-N'-[3-[3-(3-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]propanoyl]-1H-pyrrole-2-carbohydrazide |
| SMILES | Cc1cccc(-c2n[nH]c(=S)n2CCC(=O)NNC(=O)c2cc(Br)c[nH]2)c1 |
| InChI | InChI=1S/C17H17BrN6O2S/c1-10-3-2-4-11(7-10)15-21-23-17(27)24(15)6-5-14(25)20-22-16(26)13-8-12(18)9-19-13/h2-4,7-9,19H,5-6H2,1H3,(H,20,25)(H,22,26)(H,23,27) |
| InChIKey | YDMUGFCGOXYCGO-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 107.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.33 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|