C18H21N7OS — CID 26121509
N'-(4,6-dimethylpyrimidin-2-yl)-3-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]propanehydrazide (PubChem CID 26121509) has the molecular formula C18H21N7OS and a molecular weight of 383.48 g/mol. Its IUPAC name is N'-(4,6-dimethylpyrimidin-2-yl)-3-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]propanehydrazide.
| Compound Name | N'-(4,6-dimethylpyrimidin-2-yl)-3-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]propanehydrazide |
|---|---|
| PubChem CID | 26121509 |
| Molecular Formula | C18H21N7OS |
| Molecular Weight | 383.48 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | N'-(4,6-dimethylpyrimidin-2-yl)-3-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]propanehydrazide |
| SMILES | Cc1ccc(-c2n[nH]c(=S)n2CCC(=O)NNc2nc(C)cc(C)n2)cc1 |
| InChI | InChI=1S/C18H21N7OS/c1-11-4-6-14(7-5-11)16-22-24-18(27)25(16)9-8-15(26)21-23-17-19-12(2)10-13(3)20-17/h4-7,10H,8-9H2,1-3H3,(H,21,26)(H,24,27)(H,19,20,23) |
| InChIKey | XMGCCKJLJFAYGL-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.48 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|