C24H28N4OS — CID 40895619
3-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-[(1S)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]propanamide (PubChem CID 40895619) has the molecular formula C24H28N4OS and a molecular weight of 420.58 g/mol. Its IUPAC name is 3-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-[(1S)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]propanamide.
| Compound Name | 3-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-[(1S)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 40895619 |
| Molecular Formula | C24H28N4OS |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | 3-[3-(4-methylphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-N-[(1S)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]propanamide |
| SMILES | Cc1ccc(-c2n[nH]c(=S)n2CCC(=O)N[C@@H](C)c2ccc3c(c2)CCCC3)cc1 |
| InChI | InChI=1S/C24H28N4OS/c1-16-7-9-19(10-8-16)23-26-27-24(30)28(23)14-13-22(29)25-17(2)20-12-11-18-5-3-4-6-21(18)15-20/h7-12,15,17H,3-6,13-14H2,1-2H3,(H,25,29)(H,27,30)/t17-/m0/s1 |
| InChIKey | UUNOBFWYMRSCNY-KRWDZBQOSA-N |
| XLogP | 5.06 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|