C19H21FN2O2S3 — CID 24644354
N'-[5-(dithiolan-3-yl)pentanoyl]-5-(4-fluorophenyl)thiophene-2-carbohydrazide (PubChem CID 24644354) has the molecular formula C19H21FN2O2S3 and a molecular weight of 424.59 g/mol. Its IUPAC name is N'-[5-(dithiolan-3-yl)pentanoyl]-5-(4-fluorophenyl)thiophene-2-carbohydrazide.
| Compound Name | N'-[5-(dithiolan-3-yl)pentanoyl]-5-(4-fluorophenyl)thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 24644354 |
| Molecular Formula | C19H21FN2O2S3 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.07 |
| IUPAC Name | N'-[5-(dithiolan-3-yl)pentanoyl]-5-(4-fluorophenyl)thiophene-2-carbohydrazide |
| SMILES | O=C(CCCCC1CCSS1)NNC(=O)c1ccc(-c2ccc(F)cc2)s1 |
| InChI | InChI=1S/C19H21FN2O2S3/c20-14-7-5-13(6-8-14)16-9-10-17(26-16)19(24)22-21-18(23)4-2-1-3-15-11-12-25-27-15/h5-10,15H,1-4,11-12H2,(H,21,23)(H,22,24) |
| InChIKey | QKOLMKFLTGBPFT-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|