C13H13NO3S2 — CID 101377782
N-(4-methylphenyl)sulfonyl-2-thiophen-3-ylacetamide (PubChem CID 101377782) has the molecular formula C13H13NO3S2 and a molecular weight of 295.38 g/mol. Its IUPAC name is N-(4-methylphenyl)sulfonyl-2-thiophen-3-ylacetamide.
| Compound Name | N-(4-methylphenyl)sulfonyl-2-thiophen-3-ylacetamide |
|---|---|
| PubChem CID | 101377782 |
| Molecular Formula | C13H13NO3S2 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | N-(4-methylphenyl)sulfonyl-2-thiophen-3-ylacetamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)Cc2ccsc2)cc1 |
| InChI | InChI=1S/C13H13NO3S2/c1-10-2-4-12(5-3-10)19(16,17)14-13(15)8-11-6-7-18-9-11/h2-7,9H,8H2,1H3,(H,14,15) |
| InChIKey | WOOBFPQDNBXDOF-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |