C12H17NO5S2 — CID 124841964
methyl (2S,3R)-2-methyl-3-[(2-thiophen-3-ylacetyl)sulfamoyl]butanoate (PubChem CID 124841964) has the molecular formula C12H17NO5S2 and a molecular weight of 319.40 g/mol. Its IUPAC name is methyl (2S,3R)-2-methyl-3-[(2-thiophen-3-ylacetyl)sulfamoyl]butanoate.
| Compound Name | methyl (2S,3R)-2-methyl-3-[(2-thiophen-3-ylacetyl)sulfamoyl]butanoate |
|---|---|
| PubChem CID | 124841964 |
| Molecular Formula | C12H17NO5S2 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | methyl (2S,3R)-2-methyl-3-[(2-thiophen-3-ylacetyl)sulfamoyl]butanoate |
| SMILES | COC(=O)[C@H](C)[C@@H](C)S(=O)(=O)NC(=O)Cc1ccsc1 |
| InChI | InChI=1S/C12H17NO5S2/c1-8(12(15)18-3)9(2)20(16,17)13-11(14)6-10-4-5-19-7-10/h4-5,7-9H,6H2,1-3H3,(H,13,14)/t8-,9-/m1/s1 |
| InChIKey | BJBATGZFRUTXQF-RKDXNWHRSA-N |
| XLogP | 0.93 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |