C13H18N4O4S2 — CID 22203400
1-ethyl-N-[4-(ethylsulfamoyl)phenyl]pyrazole-4-sulfonamide (PubChem CID 22203400) has the molecular formula C13H18N4O4S2 and a molecular weight of 358.45 g/mol. Its IUPAC name is 1-ethyl-N-[4-(ethylsulfamoyl)phenyl]pyrazole-4-sulfonamide.
| Compound Name | 1-ethyl-N-[4-(ethylsulfamoyl)phenyl]pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 22203400 |
| Molecular Formula | C13H18N4O4S2 |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | 1-ethyl-N-[4-(ethylsulfamoyl)phenyl]pyrazole-4-sulfonamide |
| SMILES | CCNS(=O)(=O)c1ccc(NS(=O)(=O)c2cnn(CC)c2)cc1 |
| InChI | InChI=1S/C13H18N4O4S2/c1-3-15-22(18,19)12-7-5-11(6-8-12)16-23(20,21)13-9-14-17(4-2)10-13/h5-10,15-16H,3-4H2,1-2H3 |
| InChIKey | FMDUNRUHIFOWQX-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |