C16H18N6O5S2 — CID 22204073
1-ethyl-N-[4-[(6-methoxypyrimidin-4-yl)sulfamoyl]phenyl]pyrazole-4-sulfonamide (PubChem CID 22204073) has the molecular formula C16H18N6O5S2 and a molecular weight of 438.49 g/mol. Its IUPAC name is 1-ethyl-N-[4-[(6-methoxypyrimidin-4-yl)sulfamoyl]phenyl]pyrazole-4-sulfonamide.
| Compound Name | 1-ethyl-N-[4-[(6-methoxypyrimidin-4-yl)sulfamoyl]phenyl]pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 22204073 |
| Molecular Formula | C16H18N6O5S2 |
| Molecular Weight | 438.49 g/mol |
| Exact Mass | 438.08 |
| IUPAC Name | 1-ethyl-N-[4-[(6-methoxypyrimidin-4-yl)sulfamoyl]phenyl]pyrazole-4-sulfonamide |
| SMILES | CCn1cc(S(=O)(=O)Nc2ccc(S(=O)(=O)Nc3cc(OC)ncn3)cc2)cn1 |
| InChI | InChI=1S/C16H18N6O5S2/c1-3-22-10-14(9-19-22)29(25,26)20-12-4-6-13(7-5-12)28(23,24)21-15-8-16(27-2)18-11-17-15/h4-11,20H,3H2,1-2H3,(H,17,18,21) |
| InChIKey | DNFASASYMXBWJC-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 145.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.49 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |