C16H15IN6O4S — CID 1017818
4-iodo-N-[4-[(6-methoxypyrimidin-4-yl)sulfamoyl]phenyl]-1-methylpyrazole-3-carboxamide (PubChem CID 1017818) has the molecular formula C16H15IN6O4S and a molecular weight of 514.31 g/mol. Its IUPAC name is 4-iodo-N-[4-[(6-methoxypyrimidin-4-yl)sulfamoyl]phenyl]-1-methylpyrazole-3-carboxamide.
| Compound Name | 4-iodo-N-[4-[(6-methoxypyrimidin-4-yl)sulfamoyl]phenyl]-1-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 1017818 |
| Molecular Formula | C16H15IN6O4S |
| Molecular Weight | 514.31 g/mol |
| Exact Mass | 513.99 |
| IUPAC Name | 4-iodo-N-[4-[(6-methoxypyrimidin-4-yl)sulfamoyl]phenyl]-1-methylpyrazole-3-carboxamide |
| SMILES | COc1cc(NS(=O)(=O)c2ccc(NC(=O)c3nn(C)cc3I)cc2)ncn1 |
| InChI | InChI=1S/C16H15IN6O4S/c1-23-8-12(17)15(21-23)16(24)20-10-3-5-11(6-4-10)28(25,26)22-13-7-14(27-2)19-9-18-13/h3-9H,1-2H3,(H,20,24)(H,18,19,22) |
| InChIKey | USRZVCGFRYFURB-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 128.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.31 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|