C16H25Cl2N5O — CID 143176342
1-[2-[(3,5-dichloro-4-pyridinyl)amino]ethyl]-3-(3-piperidin-1-ylpropyl)urea (PubChem CID 143176342) has the molecular formula C16H25Cl2N5O and a molecular weight of 374.32 g/mol. Its IUPAC name is 1-[2-[(3,5-dichloro-4-pyridinyl)amino]ethyl]-3-(3-piperidin-1-ylpropyl)urea.
| Compound Name | 1-[2-[(3,5-dichloro-4-pyridinyl)amino]ethyl]-3-(3-piperidin-1-ylpropyl)urea |
|---|---|
| PubChem CID | 143176342 |
| Molecular Formula | C16H25Cl2N5O |
| Molecular Weight | 374.32 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | 1-[2-[(3,5-dichloro-4-pyridinyl)amino]ethyl]-3-(3-piperidin-1-ylpropyl)urea |
| SMILES | O=C(NCCCN1CCCCC1)NCCNc1c(Cl)cncc1Cl |
| InChI | InChI=1S/C16H25Cl2N5O/c17-13-11-19-12-14(18)15(13)20-6-7-22-16(24)21-5-4-10-23-8-2-1-3-9-23/h11-12H,1-10H2,(H,19,20)(H2,21,22,24) |
| InChIKey | HNTPIIQVPWDCHQ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.32 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|