C21H28ClN7O — CID 74625271
5-(3-chlorophenyl)-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]pyrazolidine-3-carboxamide (PubChem CID 74625271) has the molecular formula C21H28ClN7O and a molecular weight of 429.96 g/mol. Its IUPAC name is 5-(3-chlorophenyl)-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]pyrazolidine-3-carboxamide.
| Compound Name | 5-(3-chlorophenyl)-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]pyrazolidine-3-carboxamide |
|---|---|
| PubChem CID | 74625271 |
| Molecular Formula | C21H28ClN7O |
| Molecular Weight | 429.96 g/mol |
| Exact Mass | 429.20 |
| IUPAC Name | 5-(3-chlorophenyl)-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]pyrazolidine-3-carboxamide |
| SMILES | O=C(NCCCN1CCN(c2ncccn2)CC1)C1CC(c2cccc(Cl)c2)NN1 |
| InChI | InChI=1S/C21H28ClN7O/c22-17-5-1-4-16(14-17)18-15-19(27-26-18)20(30)23-8-3-9-28-10-12-29(13-11-28)21-24-6-2-7-25-21/h1-2,4-7,14,18-19,26-27H,3,8-13,15H2,(H,23,30) |
| InChIKey | CFQLDVOJFRKGGW-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 85.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.96 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|