C22H27ClN6O2 — CID 39117461
(3S)-1-(3-chlorophenyl)-5-oxo-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]pyrrolidine-3-carboxamide (PubChem CID 39117461) has the molecular formula C22H27ClN6O2 and a molecular weight of 442.95 g/mol. Its IUPAC name is (3S)-1-(3-chlorophenyl)-5-oxo-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]pyrrolidine-3-carboxamide.
| Compound Name | (3S)-1-(3-chlorophenyl)-5-oxo-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 39117461 |
| Molecular Formula | C22H27ClN6O2 |
| Molecular Weight | 442.95 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | (3S)-1-(3-chlorophenyl)-5-oxo-N-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]pyrrolidine-3-carboxamide |
| SMILES | O=C(NCCCN1CCN(c2ncccn2)CC1)[C@H]1CC(=O)N(c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C22H27ClN6O2/c23-18-4-1-5-19(15-18)29-16-17(14-20(29)30)21(31)24-8-3-9-27-10-12-28(13-11-27)22-25-6-2-7-26-22/h1-2,4-7,15,17H,3,8-14,16H2,(H,24,31)/t17-/m0/s1 |
| InChIKey | WOPQIIXAPSDSGI-KRWDZBQOSA-N |
| XLogP | 1.81 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.95 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|