C22H28N2O5S — CID 56573315
2-(1,1-dioxo-1,4-thiazinan-4-yl)-N-[[3-(2-methoxyethoxy)phenyl]methyl]-2-phenylacetamide (PubChem CID 56573315) has the molecular formula C22H28N2O5S and a molecular weight of 432.54 g/mol. Its IUPAC name is 2-(1,1-dioxo-1,4-thiazinan-4-yl)-N-[[3-(2-methoxyethoxy)phenyl]methyl]-2-phenylacetamide.
| Compound Name | 2-(1,1-dioxo-1,4-thiazinan-4-yl)-N-[[3-(2-methoxyethoxy)phenyl]methyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 56573315 |
| Molecular Formula | C22H28N2O5S |
| Molecular Weight | 432.54 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | 2-(1,1-dioxo-1,4-thiazinan-4-yl)-N-[[3-(2-methoxyethoxy)phenyl]methyl]-2-phenylacetamide |
| SMILES | COCCOc1cccc(CNC(=O)C(c2ccccc2)N2CCS(=O)(=O)CC2)c1 |
| InChI | InChI=1S/C22H28N2O5S/c1-28-12-13-29-20-9-5-6-18(16-20)17-23-22(25)21(19-7-3-2-4-8-19)24-10-14-30(26,27)15-11-24/h2-9,16,21H,10-15,17H2,1H3,(H,23,25) |
| InChIKey | UUCXUTYQDITZRX-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.54 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|