C17H21F4N3O3 — CID 86868045
N-[2-(3-fluorophenoxy)ethyl]-2-[4-(3,3,3-trifluoropropanoyl)piperazin-1-yl]acetamide (PubChem CID 86868045) has the molecular formula C17H21F4N3O3 and a molecular weight of 391.37 g/mol. Its IUPAC name is N-[2-(3-fluorophenoxy)ethyl]-2-[4-(3,3,3-trifluoropropanoyl)piperazin-1-yl]acetamide.
| Compound Name | N-[2-(3-fluorophenoxy)ethyl]-2-[4-(3,3,3-trifluoropropanoyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 86868045 |
| Molecular Formula | C17H21F4N3O3 |
| Molecular Weight | 391.37 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | N-[2-(3-fluorophenoxy)ethyl]-2-[4-(3,3,3-trifluoropropanoyl)piperazin-1-yl]acetamide |
| SMILES | O=C(CN1CCN(C(=O)CC(F)(F)F)CC1)NCCOc1cccc(F)c1 |
| InChI | InChI=1S/C17H21F4N3O3/c18-13-2-1-3-14(10-13)27-9-4-22-15(25)12-23-5-7-24(8-6-23)16(26)11-17(19,20)21/h1-3,10H,4-9,11-12H2,(H,22,25) |
| InChIKey | UHPJICGGZKUTAM-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.37 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|