C20H21F4N3O2 — CID 38336448
N-[2-(3-fluorophenoxy)ethyl]-4-[3-(trifluoromethyl)phenyl]piperazine-1-carboxamide (PubChem CID 38336448) has the molecular formula C20H21F4N3O2 and a molecular weight of 411.40 g/mol. Its IUPAC name is N-[2-(3-fluorophenoxy)ethyl]-4-[3-(trifluoromethyl)phenyl]piperazine-1-carboxamide.
| Compound Name | N-[2-(3-fluorophenoxy)ethyl]-4-[3-(trifluoromethyl)phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 38336448 |
| Molecular Formula | C20H21F4N3O2 |
| Molecular Weight | 411.40 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | N-[2-(3-fluorophenoxy)ethyl]-4-[3-(trifluoromethyl)phenyl]piperazine-1-carboxamide |
| SMILES | O=C(NCCOc1cccc(F)c1)N1CCN(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C20H21F4N3O2/c21-16-4-2-6-18(14-16)29-12-7-25-19(28)27-10-8-26(9-11-27)17-5-1-3-15(13-17)20(22,23)24/h1-6,13-14H,7-12H2,(H,25,28) |
| InChIKey | LKKQRPFHUPFMNX-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.40 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|