C22H24F3N3O — CID 46699763
N-[(1-phenylcyclopropyl)methyl]-4-[3-(trifluoromethyl)phenyl]piperazine-1-carboxamide (PubChem CID 46699763) has the molecular formula C22H24F3N3O and a molecular weight of 403.45 g/mol. Its IUPAC name is N-[(1-phenylcyclopropyl)methyl]-4-[3-(trifluoromethyl)phenyl]piperazine-1-carboxamide.
| Compound Name | N-[(1-phenylcyclopropyl)methyl]-4-[3-(trifluoromethyl)phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 46699763 |
| Molecular Formula | C22H24F3N3O |
| Molecular Weight | 403.45 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | N-[(1-phenylcyclopropyl)methyl]-4-[3-(trifluoromethyl)phenyl]piperazine-1-carboxamide |
| SMILES | O=C(NCC1(c2ccccc2)CC1)N1CCN(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C22H24F3N3O/c23-22(24,25)18-7-4-8-19(15-18)27-11-13-28(14-12-27)20(29)26-16-21(9-10-21)17-5-2-1-3-6-17/h1-8,15H,9-14,16H2,(H,26,29) |
| InChIKey | UZTIFCLWNKESPC-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.45 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |