C21H25F3N4O — CID 112806983
N-[2-(N-methylanilino)ethyl]-4-[3-(trifluoromethyl)phenyl]piperazine-1-carboxamide (PubChem CID 112806983) has the molecular formula C21H25F3N4O and a molecular weight of 406.45 g/mol. Its IUPAC name is N-[2-(N-methylanilino)ethyl]-4-[3-(trifluoromethyl)phenyl]piperazine-1-carboxamide.
| Compound Name | N-[2-(N-methylanilino)ethyl]-4-[3-(trifluoromethyl)phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 112806983 |
| Molecular Formula | C21H25F3N4O |
| Molecular Weight | 406.45 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | N-[2-(N-methylanilino)ethyl]-4-[3-(trifluoromethyl)phenyl]piperazine-1-carboxamide |
| SMILES | CN(CCNC(=O)N1CCN(c2cccc(C(F)(F)F)c2)CC1)c1ccccc1 |
| InChI | InChI=1S/C21H25F3N4O/c1-26(18-7-3-2-4-8-18)11-10-25-20(29)28-14-12-27(13-15-28)19-9-5-6-17(16-19)21(22,23)24/h2-9,16H,10-15H2,1H3,(H,25,29) |
| InChIKey | DBUONUDYMLXUJG-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.45 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |