C22H26ClN3O — CID 113214019
4-(3-chlorophenyl)-N-[[1-(4-methylphenyl)cyclopropyl]methyl]piperazine-1-carboxamide (PubChem CID 113214019) has the molecular formula C22H26ClN3O and a molecular weight of 383.92 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-N-[[1-(4-methylphenyl)cyclopropyl]methyl]piperazine-1-carboxamide.
| Compound Name | 4-(3-chlorophenyl)-N-[[1-(4-methylphenyl)cyclopropyl]methyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 113214019 |
| Molecular Formula | C22H26ClN3O |
| Molecular Weight | 383.92 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | 4-(3-chlorophenyl)-N-[[1-(4-methylphenyl)cyclopropyl]methyl]piperazine-1-carboxamide |
| SMILES | Cc1ccc(C2(CNC(=O)N3CCN(c4cccc(Cl)c4)CC3)CC2)cc1 |
| InChI | InChI=1S/C22H26ClN3O/c1-17-5-7-18(8-6-17)22(9-10-22)16-24-21(27)26-13-11-25(12-14-26)20-4-2-3-19(23)15-20/h2-8,15H,9-14,16H2,1H3,(H,24,27) |
| InChIKey | OHAWZAXNVXVBLY-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.92 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |