C21H19N3O4S — CID 8728238
[2-[2-(cyanomethylsulfanyl)anilino]-2-oxoethyl] 3-(2-oxopyrrolidin-1-yl)benzoate (PubChem CID 8728238) has the molecular formula C21H19N3O4S and a molecular weight of 409.47 g/mol. Its IUPAC name is [2-[2-(cyanomethylsulfanyl)anilino]-2-oxoethyl] 3-(2-oxopyrrolidin-1-yl)benzoate.
| Compound Name | [2-[2-(cyanomethylsulfanyl)anilino]-2-oxoethyl] 3-(2-oxopyrrolidin-1-yl)benzoate |
|---|---|
| PubChem CID | 8728238 |
| Molecular Formula | C21H19N3O4S |
| Molecular Weight | 409.47 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | [2-[2-(cyanomethylsulfanyl)anilino]-2-oxoethyl] 3-(2-oxopyrrolidin-1-yl)benzoate |
| SMILES | N#CCSc1ccccc1NC(=O)COC(=O)c1cccc(N2CCCC2=O)c1 |
| InChI | InChI=1S/C21H19N3O4S/c22-10-12-29-18-8-2-1-7-17(18)23-19(25)14-28-21(27)15-5-3-6-16(13-15)24-11-4-9-20(24)26/h1-3,5-8,13H,4,9,11-12,14H2,(H,23,25) |
| InChIKey | FUMSJRDJWLARFQ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.47 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |