C19H17F3N2O3S — CID 78889287
2-[3-(2-oxopyrrolidin-1-yl)phenoxy]-N-[2-(trifluoromethylsulfanyl)phenyl]acetamide (PubChem CID 78889287) has the molecular formula C19H17F3N2O3S and a molecular weight of 410.42 g/mol. Its IUPAC name is 2-[3-(2-oxopyrrolidin-1-yl)phenoxy]-N-[2-(trifluoromethylsulfanyl)phenyl]acetamide.
| Compound Name | 2-[3-(2-oxopyrrolidin-1-yl)phenoxy]-N-[2-(trifluoromethylsulfanyl)phenyl]acetamide |
|---|---|
| PubChem CID | 78889287 |
| Molecular Formula | C19H17F3N2O3S |
| Molecular Weight | 410.42 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | 2-[3-(2-oxopyrrolidin-1-yl)phenoxy]-N-[2-(trifluoromethylsulfanyl)phenyl]acetamide |
| SMILES | O=C(COc1cccc(N2CCCC2=O)c1)Nc1ccccc1SC(F)(F)F |
| InChI | InChI=1S/C19H17F3N2O3S/c20-19(21,22)28-16-8-2-1-7-15(16)23-17(25)12-27-14-6-3-5-13(11-14)24-10-4-9-18(24)26/h1-3,5-8,11H,4,9-10,12H2,(H,23,25) |
| InChIKey | JGXZYPQJIUFTOX-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.42 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |