C29H27ClN2O4 — CID 87598299
(2E,4E)-5-(4-chlorophenyl)-N-(3-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-5-yl)-5-(4-propan-2-yloxyphenyl)penta-2,4-dienamide (PubChem CID 87598299) has the molecular formula C29H27ClN2O4 and a molecular weight of 503.00 g/mol. Its IUPAC name is (2E,4E)-5-(4-chlorophenyl)-N-(3-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-5-yl)-5-(4-propan-2-yloxyphenyl)penta-2,4-dienamide.
| Compound Name | (2E,4E)-5-(4-chlorophenyl)-N-(3-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-5-yl)-5-(4-propan-2-yloxyphenyl)penta-2,4-dienamide |
|---|---|
| PubChem CID | 87598299 |
| Molecular Formula | C29H27ClN2O4 |
| Molecular Weight | 503.00 g/mol |
| Exact Mass | 502.17 |
| IUPAC Name | (2E,4E)-5-(4-chlorophenyl)-N-(3-hydroxy-2-oxo-3,4-dihydro-1H-quinolin-5-yl)-5-(4-propan-2-yloxyphenyl)penta-2,4-dienamide |
| SMILES | CC(C)Oc1ccc(/C(=C\C=C\C(=O)Nc2cccc3c2CC(O)C(=O)N3)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C29H27ClN2O4/c1-18(2)36-22-15-11-20(12-16-22)23(19-9-13-21(30)14-10-19)5-3-8-28(34)31-25-6-4-7-26-24(25)17-27(33)29(35)32-26/h3-16,18,27,33H,17H2,1-2H3,(H,31,34)(H,32,35)/b8-3+,23-5- |
| InChIKey | VJPZZVQRJUZXEX-WJLABUQWSA-N |
| XLogP | 5.61 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.00 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|