C17H14N2O2 — CID 52936781
4-methyl-N-(1-oxo-2H-isoquinolin-5-yl)benzamide (PubChem CID 52936781) has the molecular formula C17H14N2O2 and a molecular weight of 278.31 g/mol. Its IUPAC name is 4-methyl-N-(1-oxo-2H-isoquinolin-5-yl)benzamide.
| Compound Name | 4-methyl-N-(1-oxo-2H-isoquinolin-5-yl)benzamide |
|---|---|
| PubChem CID | 52936781 |
| Molecular Formula | C17H14N2O2 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 4-methyl-N-(1-oxo-2H-isoquinolin-5-yl)benzamide |
| SMILES | Cc1ccc(C(=O)Nc2cccc3c(=O)[nH]ccc23)cc1 |
| InChI | InChI=1S/C17H14N2O2/c1-11-5-7-12(8-6-11)16(20)19-15-4-2-3-14-13(15)9-10-18-17(14)21/h2-10H,1H3,(H,18,21)(H,19,20) |
| InChIKey | ILBWWQBNKIIFFE-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |