C21H27ClN2O4 — CID 60600491
3-[3-chloro-2-(2-ethoxyethoxy)phenyl]-1-methyl-1-[2-(4-methylphenoxy)ethyl]urea (PubChem CID 60600491) has the molecular formula C21H27ClN2O4 and a molecular weight of 406.91 g/mol. Its IUPAC name is 3-[3-chloro-2-(2-ethoxyethoxy)phenyl]-1-methyl-1-[2-(4-methylphenoxy)ethyl]urea.
| Compound Name | 3-[3-chloro-2-(2-ethoxyethoxy)phenyl]-1-methyl-1-[2-(4-methylphenoxy)ethyl]urea |
|---|---|
| PubChem CID | 60600491 |
| Molecular Formula | C21H27ClN2O4 |
| Molecular Weight | 406.91 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | 3-[3-chloro-2-(2-ethoxyethoxy)phenyl]-1-methyl-1-[2-(4-methylphenoxy)ethyl]urea |
| SMILES | CCOCCOc1c(Cl)cccc1NC(=O)N(C)CCOc1ccc(C)cc1 |
| InChI | InChI=1S/C21H27ClN2O4/c1-4-26-14-15-28-20-18(22)6-5-7-19(20)23-21(25)24(3)12-13-27-17-10-8-16(2)9-11-17/h5-11H,4,12-15H2,1-3H3,(H,23,25) |
| InChIKey | JWNTZKVKDVFPMD-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.91 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|