C13H16Cl2N2O3 — CID 79256587
2-[tert-butyl-[(2,3-dichlorophenyl)carbamoyl]amino]acetic acid (PubChem CID 79256587) has the molecular formula C13H16Cl2N2O3 and a molecular weight of 319.19 g/mol. Its IUPAC name is 2-[tert-butyl-[(2,3-dichlorophenyl)carbamoyl]amino]acetic acid.
| Compound Name | 2-[tert-butyl-[(2,3-dichlorophenyl)carbamoyl]amino]acetic acid |
|---|---|
| PubChem CID | 79256587 |
| Molecular Formula | C13H16Cl2N2O3 |
| Molecular Weight | 319.19 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | 2-[tert-butyl-[(2,3-dichlorophenyl)carbamoyl]amino]acetic acid |
| SMILES | CC(C)(C)N(CC(=O)O)C(=O)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C13H16Cl2N2O3/c1-13(2,3)17(7-10(18)19)12(20)16-9-6-4-5-8(14)11(9)15/h4-6H,7H2,1-3H3,(H,16,20)(H,18,19) |
| InChIKey | SUYMHAJADOXKAW-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.19 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |