C18H16ClN5 — CID 6819890
2-chloro-N-[1-(3-phenyl-1,2,4-triazin-5-yl)propylideneamino]aniline (PubChem CID 6819890) has the molecular formula C18H16ClN5 and a molecular weight of 337.81 g/mol. Its IUPAC name is 2-chloro-N-[1-(3-phenyl-1,2,4-triazin-5-yl)propylideneamino]aniline.
| Compound Name | 2-chloro-N-[1-(3-phenyl-1,2,4-triazin-5-yl)propylideneamino]aniline |
|---|---|
| PubChem CID | 6819890 |
| Molecular Formula | C18H16ClN5 |
| Molecular Weight | 337.81 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | 2-chloro-N-[1-(3-phenyl-1,2,4-triazin-5-yl)propylideneamino]aniline |
| SMILES | CCC(=NNc1ccccc1Cl)c1cnnc(-c2ccccc2)n1 |
| InChI | InChI=1S/C18H16ClN5/c1-2-15(22-23-16-11-7-6-10-14(16)19)17-12-20-24-18(21-17)13-8-4-3-5-9-13/h3-12,23H,2H2,1H3 |
| InChIKey | UBZYWMUEMJAFOX-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 63.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.81 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|