C10H10ClN5 — CID 3053954
1-[5-(3-chlorophenyl)-1,2,4-triazin-3-yl]-2-methylhydrazine (PubChem CID 3053954) has the molecular formula C10H10ClN5 and a molecular weight of 235.68 g/mol. Its IUPAC name is 1-[5-(3-chlorophenyl)-1,2,4-triazin-3-yl]-2-methylhydrazine.
| Compound Name | 1-[5-(3-chlorophenyl)-1,2,4-triazin-3-yl]-2-methylhydrazine |
|---|---|
| PubChem CID | 3053954 |
| Molecular Formula | C10H10ClN5 |
| Molecular Weight | 235.68 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | 1-[5-(3-chlorophenyl)-1,2,4-triazin-3-yl]-2-methylhydrazine |
| SMILES | CNNc1nncc(-c2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C10H10ClN5/c1-12-15-10-14-9(6-13-16-10)7-3-2-4-8(11)5-7/h2-6,12H,1H3,(H,14,15,16) |
| InChIKey | FTEXCCNCJIPQQW-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.68 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|