C9H7Cl2N5 — CID 3053951
[5-(3,4-dichlorophenyl)-1,2,4-triazin-3-yl]hydrazine (PubChem CID 3053951) has the molecular formula C9H7Cl2N5 and a molecular weight of 256.10 g/mol. Its IUPAC name is [5-(3,4-dichlorophenyl)-1,2,4-triazin-3-yl]hydrazine.
| Compound Name | [5-(3,4-dichlorophenyl)-1,2,4-triazin-3-yl]hydrazine |
|---|---|
| PubChem CID | 3053951 |
| Molecular Formula | C9H7Cl2N5 |
| Molecular Weight | 256.10 g/mol |
| Exact Mass | 255.01 |
| IUPAC Name | [5-(3,4-dichlorophenyl)-1,2,4-triazin-3-yl]hydrazine |
| SMILES | NNc1nncc(-c2ccc(Cl)c(Cl)c2)n1 |
| InChI | InChI=1S/C9H7Cl2N5/c10-6-2-1-5(3-7(6)11)8-4-13-16-9(14-8)15-12/h1-4H,12H2,(H,14,15,16) |
| InChIKey | VMDWVMXBXNJYMH-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.10 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|