C9H8ClN5 — CID 3042263
[5-(4-chlorophenyl)-1,2,4-triazin-3-yl]hydrazine (PubChem CID 3042263) has the molecular formula C9H8ClN5 and a molecular weight of 221.65 g/mol. Its IUPAC name is [5-(4-chlorophenyl)-1,2,4-triazin-3-yl]hydrazine.
| Compound Name | [5-(4-chlorophenyl)-1,2,4-triazin-3-yl]hydrazine |
|---|---|
| PubChem CID | 3042263 |
| Molecular Formula | C9H8ClN5 |
| Molecular Weight | 221.65 g/mol |
| Exact Mass | 221.05 |
| IUPAC Name | [5-(4-chlorophenyl)-1,2,4-triazin-3-yl]hydrazine |
| SMILES | NNc1nncc(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C9H8ClN5/c10-7-3-1-6(2-4-7)8-5-12-15-9(13-8)14-11/h1-5H,11H2,(H,13,14,15) |
| InChIKey | KNBBECLZSZIELM-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.65 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|