C18H17N5 — CID 56642870
N-[(Z)-1-(3-phenyl-1,2,4-triazin-5-yl)propylideneamino]aniline (PubChem CID 56642870) has the molecular formula C18H17N5 and a molecular weight of 303.37 g/mol. Its IUPAC name is N-[(Z)-1-(3-phenyl-1,2,4-triazin-5-yl)propylideneamino]aniline.
| Compound Name | N-[(Z)-1-(3-phenyl-1,2,4-triazin-5-yl)propylideneamino]aniline |
|---|---|
| PubChem CID | 56642870 |
| Molecular Formula | C18H17N5 |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | N-[(Z)-1-(3-phenyl-1,2,4-triazin-5-yl)propylideneamino]aniline |
| SMILES | CC/C(=N/Nc1ccccc1)c1cnnc(-c2ccccc2)n1 |
| InChI | InChI=1S/C18H17N5/c1-2-16(22-21-15-11-7-4-8-12-15)17-13-19-23-18(20-17)14-9-5-3-6-10-14/h3-13,21H,2H2,1H3/b22-16- |
| InChIKey | HAFRYEPETBIRAO-JWGURIENSA-N |
| XLogP | 3.76 |
| TPSA | 63.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|