C13H14ClN5S — CID 15945545
4-chloro-N-[1-(3-methylsulfanyl-1,2,4-triazin-5-yl)propylideneamino]aniline (PubChem CID 15945545) has the molecular formula C13H14ClN5S and a molecular weight of 307.81 g/mol. Its IUPAC name is 4-chloro-N-[1-(3-methylsulfanyl-1,2,4-triazin-5-yl)propylideneamino]aniline.
| Compound Name | 4-chloro-N-[1-(3-methylsulfanyl-1,2,4-triazin-5-yl)propylideneamino]aniline |
|---|---|
| PubChem CID | 15945545 |
| Molecular Formula | C13H14ClN5S |
| Molecular Weight | 307.81 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | 4-chloro-N-[1-(3-methylsulfanyl-1,2,4-triazin-5-yl)propylideneamino]aniline |
| SMILES | CCC(=NNc1ccc(Cl)cc1)c1cnnc(SC)n1 |
| InChI | InChI=1S/C13H14ClN5S/c1-3-11(12-8-15-19-13(16-12)20-2)18-17-10-6-4-9(14)5-7-10/h4-8,17H,3H2,1-2H3 |
| InChIKey | PXWSEQOYCPOXDK-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 63.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.81 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|