C9H8N4 — CID 15272334
3-phenyl-1,2,4-triazin-5-amine (PubChem CID 15272334) has the molecular formula C9H8N4 and a molecular weight of 172.19 g/mol. Its IUPAC name is 3-phenyl-1,2,4-triazin-5-amine.
| Compound Name | 3-phenyl-1,2,4-triazin-5-amine |
|---|---|
| PubChem CID | 15272334 |
| Molecular Formula | C9H8N4 |
| Molecular Weight | 172.19 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | 3-phenyl-1,2,4-triazin-5-amine |
| SMILES | Nc1cnnc(-c2ccccc2)n1 |
| InChI | InChI=1S/C9H8N4/c10-8-6-11-13-9(12-8)7-4-2-1-3-5-7/h1-6H,(H2,10,12,13) |
| InChIKey | SJXIQUPKRXWFJC-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.19 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |