C10H12N4 — CID 177031357
ethane;3-phenyl-1,2,4,5-tetrazine (PubChem CID 177031357) has the molecular formula C10H12N4 and a molecular weight of 188.23 g/mol. Its IUPAC name is ethane;3-phenyl-1,2,4,5-tetrazine.
| Compound Name | ethane;3-phenyl-1,2,4,5-tetrazine |
|---|---|
| PubChem CID | 177031357 |
| Molecular Formula | C10H12N4 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.11 |
| IUPAC Name | ethane;3-phenyl-1,2,4,5-tetrazine |
| SMILES | CC.c1ccc(-c2nncnn2)cc1 |
| InChI | InChI=1S/C8H6N4.C2H6/c1-2-4-7(5-3-1)8-11-9-6-10-12-8;1-2/h1-6H;1-2H3 |
| InChIKey | JIOVAEVFSCMFLQ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |