C9H7BrN4 — CID 83547754
3-(3-bromophenyl)-1,2,4-triazin-5-amine (PubChem CID 83547754) has the molecular formula C9H7BrN4 and a molecular weight of 251.09 g/mol. Its IUPAC name is 3-(3-bromophenyl)-1,2,4-triazin-5-amine.
| Compound Name | 3-(3-bromophenyl)-1,2,4-triazin-5-amine |
|---|---|
| PubChem CID | 83547754 |
| Molecular Formula | C9H7BrN4 |
| Molecular Weight | 251.09 g/mol |
| Exact Mass | 249.99 |
| IUPAC Name | 3-(3-bromophenyl)-1,2,4-triazin-5-amine |
| SMILES | Nc1cnnc(-c2cccc(Br)c2)n1 |
| InChI | InChI=1S/C9H7BrN4/c10-7-3-1-2-6(4-7)9-13-8(11)5-12-14-9/h1-5H,(H2,11,13,14) |
| InChIKey | BAHAPVLKCZJSQQ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.09 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |