C10H9BrN4 — CID 116823963
3-(3-bromophenyl)-N-methyl-1,2,4-triazin-5-amine (PubChem CID 116823963) has the molecular formula C10H9BrN4 and a molecular weight of 265.11 g/mol. Its IUPAC name is 3-(3-bromophenyl)-N-methyl-1,2,4-triazin-5-amine.
| Compound Name | 3-(3-bromophenyl)-N-methyl-1,2,4-triazin-5-amine |
|---|---|
| PubChem CID | 116823963 |
| Molecular Formula | C10H9BrN4 |
| Molecular Weight | 265.11 g/mol |
| Exact Mass | 264.00 |
| IUPAC Name | 3-(3-bromophenyl)-N-methyl-1,2,4-triazin-5-amine |
| SMILES | CNc1cnnc(-c2cccc(Br)c2)n1 |
| InChI | InChI=1S/C10H9BrN4/c1-12-9-6-13-15-10(14-9)7-3-2-4-8(11)5-7/h2-6H,1H3,(H,12,14,15) |
| InChIKey | KLAYEWDKDWPXTE-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.11 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |