C12H10BrN3S — CID 83189983
2-(3-bromophenyl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-amine (PubChem CID 83189983) has the molecular formula C12H10BrN3S and a molecular weight of 308.20 g/mol. Its IUPAC name is 2-(3-bromophenyl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-amine.
| Compound Name | 2-(3-bromophenyl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 83189983 |
| Molecular Formula | C12H10BrN3S |
| Molecular Weight | 308.20 g/mol |
| Exact Mass | 306.98 |
| IUPAC Name | 2-(3-bromophenyl)-5,7-dihydrothieno[3,4-d]pyrimidin-4-amine |
| SMILES | Nc1nc(-c2cccc(Br)c2)nc2c1CSC2 |
| InChI | InChI=1S/C12H10BrN3S/c13-8-3-1-2-7(4-8)12-15-10-6-17-5-9(10)11(14)16-12/h1-4H,5-6H2,(H2,14,15,16) |
| InChIKey | XDHZBWWRJLMYDN-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.20 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |