C21H18BrN3O2S — CID 2725437
N-[3-[(4-bromo-2-methylphenyl)carbamothioylamino]phenyl]-2-hydroxybenzamide (PubChem CID 2725437) has the molecular formula C21H18BrN3O2S and a molecular weight of 456.37 g/mol. Its IUPAC name is N-[3-[(4-bromo-2-methylphenyl)carbamothioylamino]phenyl]-2-hydroxybenzamide.
| Compound Name | N-[3-[(4-bromo-2-methylphenyl)carbamothioylamino]phenyl]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 2725437 |
| Molecular Formula | C21H18BrN3O2S |
| Molecular Weight | 456.37 g/mol |
| Exact Mass | 455.03 |
| IUPAC Name | N-[3-[(4-bromo-2-methylphenyl)carbamothioylamino]phenyl]-2-hydroxybenzamide |
| SMILES | Cc1cc(Br)ccc1NC(=S)Nc1cccc(NC(=O)c2ccccc2O)c1 |
| InChI | InChI=1S/C21H18BrN3O2S/c1-13-11-14(22)9-10-18(13)25-21(28)24-16-6-4-5-15(12-16)23-20(27)17-7-2-3-8-19(17)26/h2-12,26H,1H3,(H,23,27)(H2,24,25,28) |
| InChIKey | UWQLAJRNGSJXRZ-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.37 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|