C24H24N4O4S — CID 40836847
N-[[4-[(2S)-2-methylpiperidin-1-yl]phenyl]carbamothioyl]-5-(3-nitrophenyl)furan-2-carboxamide (PubChem CID 40836847) has the molecular formula C24H24N4O4S and a molecular weight of 464.55 g/mol. Its IUPAC name is N-[[4-[(2S)-2-methylpiperidin-1-yl]phenyl]carbamothioyl]-5-(3-nitrophenyl)furan-2-carboxamide.
| Compound Name | N-[[4-[(2S)-2-methylpiperidin-1-yl]phenyl]carbamothioyl]-5-(3-nitrophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 40836847 |
| Molecular Formula | C24H24N4O4S |
| Molecular Weight | 464.55 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | N-[[4-[(2S)-2-methylpiperidin-1-yl]phenyl]carbamothioyl]-5-(3-nitrophenyl)furan-2-carboxamide |
| SMILES | C[C@H]1CCCCN1c1ccc(NC(=S)NC(=O)c2ccc(-c3cccc([N+](=O)[O-])c3)o2)cc1 |
| InChI | InChI=1S/C24H24N4O4S/c1-16-5-2-3-14-27(16)19-10-8-18(9-11-19)25-24(33)26-23(29)22-13-12-21(32-22)17-6-4-7-20(15-17)28(30)31/h4,6-13,15-16H,2-3,5,14H2,1H3,(H2,25,26,29,33)/t16-/m0/s1 |
| InChIKey | XCSWZVWFQWRTAU-INIZCTEOSA-N |
| XLogP | 5.36 |
| TPSA | 100.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.55 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|