C26H26ClN3O2S — CID 26020570
(E)-3-[5-(4-chlorophenyl)furan-2-yl]-N-[[4-[(2S)-2-methylpiperidin-1-yl]phenyl]carbamothioyl]prop-2-enamide (PubChem CID 26020570) has the molecular formula C26H26ClN3O2S and a molecular weight of 480.03 g/mol. Its IUPAC name is (E)-3-[5-(4-chlorophenyl)furan-2-yl]-N-[[4-[(2S)-2-methylpiperidin-1-yl]phenyl]carbamothioyl]prop-2-enamide.
| Compound Name | (E)-3-[5-(4-chlorophenyl)furan-2-yl]-N-[[4-[(2S)-2-methylpiperidin-1-yl]phenyl]carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 26020570 |
| Molecular Formula | C26H26ClN3O2S |
| Molecular Weight | 480.03 g/mol |
| Exact Mass | 479.14 |
| IUPAC Name | (E)-3-[5-(4-chlorophenyl)furan-2-yl]-N-[[4-[(2S)-2-methylpiperidin-1-yl]phenyl]carbamothioyl]prop-2-enamide |
| SMILES | C[C@H]1CCCCN1c1ccc(NC(=S)NC(=O)/C=C/c2ccc(-c3ccc(Cl)cc3)o2)cc1 |
| InChI | InChI=1S/C26H26ClN3O2S/c1-18-4-2-3-17-30(18)22-11-9-21(10-12-22)28-26(33)29-25(31)16-14-23-13-15-24(32-23)19-5-7-20(27)8-6-19/h5-16,18H,2-4,17H2,1H3,(H2,28,29,31,33)/b16-14+/t18-/m0/s1 |
| InChIKey | SFZBCOJZOXRGOM-ZWFBASDOSA-N |
| XLogP | 6.51 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.03 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|