C25H24Cl2N2O2 — CID 17111995
(E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]-N-[4-(2-methylpiperidin-1-yl)phenyl]prop-2-enamide (PubChem CID 17111995) has the molecular formula C25H24Cl2N2O2 and a molecular weight of 455.39 g/mol. Its IUPAC name is (E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]-N-[4-(2-methylpiperidin-1-yl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]-N-[4-(2-methylpiperidin-1-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 17111995 |
| Molecular Formula | C25H24Cl2N2O2 |
| Molecular Weight | 455.39 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | (E)-3-[5-(3,5-dichlorophenyl)furan-2-yl]-N-[4-(2-methylpiperidin-1-yl)phenyl]prop-2-enamide |
| SMILES | CC1CCCCN1c1ccc(NC(=O)/C=C/c2ccc(-c3cc(Cl)cc(Cl)c3)o2)cc1 |
| InChI | InChI=1S/C25H24Cl2N2O2/c1-17-4-2-3-13-29(17)22-7-5-21(6-8-22)28-25(30)12-10-23-9-11-24(31-23)18-14-19(26)16-20(27)15-18/h5-12,14-17H,2-4,13H2,1H3,(H,28,30)/b12-10+ |
| InChIKey | RJZXSQHCBJXWOR-ZRDIBKRKSA-N |
| XLogP | 7.28 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.39 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|