C17H18N2O7S — CID 6234837
dimethyl 5-[[(E)-4-ethoxy-4-oxobut-2-enoyl]carbamothioylamino]benzene-1,3-dicarboxylate (PubChem CID 6234837) has the molecular formula C17H18N2O7S and a molecular weight of 394.41 g/mol. Its IUPAC name is dimethyl 5-[[(E)-4-ethoxy-4-oxobut-2-enoyl]carbamothioylamino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[[(E)-4-ethoxy-4-oxobut-2-enoyl]carbamothioylamino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 6234837 |
| Molecular Formula | C17H18N2O7S |
| Molecular Weight | 394.41 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | dimethyl 5-[[(E)-4-ethoxy-4-oxobut-2-enoyl]carbamothioylamino]benzene-1,3-dicarboxylate |
| SMILES | CCOC(=O)/C=C/C(=O)NC(=S)Nc1cc(C(=O)OC)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C17H18N2O7S/c1-4-26-14(21)6-5-13(20)19-17(27)18-12-8-10(15(22)24-2)7-11(9-12)16(23)25-3/h5-9H,4H2,1-3H3,(H2,18,19,20,27)/b6-5+ |
| InChIKey | VCBLRBJWWHFKJN-AATRIKPKSA-N |
| XLogP | 1.19 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.41 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|