C13H12Cl2N2O3S — CID 4928794
ethyl 4-[(2,5-dichlorophenyl)carbamothioylamino]-4-oxobut-2-enoate (PubChem CID 4928794) has the molecular formula C13H12Cl2N2O3S and a molecular weight of 347.22 g/mol. Its IUPAC name is ethyl 4-[(2,5-dichlorophenyl)carbamothioylamino]-4-oxobut-2-enoate.
| Compound Name | ethyl 4-[(2,5-dichlorophenyl)carbamothioylamino]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 4928794 |
| Molecular Formula | C13H12Cl2N2O3S |
| Molecular Weight | 347.22 g/mol |
| Exact Mass | 345.99 |
| IUPAC Name | ethyl 4-[(2,5-dichlorophenyl)carbamothioylamino]-4-oxobut-2-enoate |
| SMILES | CCOC(=O)C=CC(=O)NC(=S)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C13H12Cl2N2O3S/c1-2-20-12(19)6-5-11(18)17-13(21)16-10-7-8(14)3-4-9(10)15/h3-7H,2H2,1H3,(H2,16,17,18,21) |
| InChIKey | CNUGIGBTDWTJHZ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.22 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|