C18H17NaO10S2 — CID 87720985
sodium 4-[3,5-bis(methoxycarbonyl)phenyl]sulfonyloxy-3,5-dimethylbenzenesulfonate (PubChem CID 87720985) has the molecular formula C18H17NaO10S2 and a molecular weight of 480.45 g/mol. Its IUPAC name is sodium 4-[3,5-bis(methoxycarbonyl)phenyl]sulfonyloxy-3,5-dimethylbenzenesulfonate.
| Compound Name | sodium 4-[3,5-bis(methoxycarbonyl)phenyl]sulfonyloxy-3,5-dimethylbenzenesulfonate |
|---|---|
| PubChem CID | 87720985 |
| Molecular Formula | C18H17NaO10S2 |
| Molecular Weight | 480.45 g/mol |
| Exact Mass | 480.02 |
| IUPAC Name | sodium 4-[3,5-bis(methoxycarbonyl)phenyl]sulfonyloxy-3,5-dimethylbenzenesulfonate |
| SMILES | COC(=O)c1cc(C(=O)OC)cc(S(=O)(=O)Oc2c(C)cc(S(=O)(=O)[O-])cc2C)c1.[Na+] |
| InChI | InChI=1S/C18H18O10S2.Na/c1-10-5-14(29(21,22)23)6-11(2)16(10)28-30(24,25)15-8-12(17(19)26-3)7-13(9-15)18(20)27-4;/h5-9H,1-4H3,(H,21,22,23);/q;+1/p-1 |
| InChIKey | CJKKRYNRJSKPHB-UHFFFAOYSA-M |
| XLogP | -1.45 |
| TPSA | 153.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.45 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|