C24H30F3NO3 — CID 142074214
benzyl 4-[hexyl-(2,2,2-trifluoroacetyl)amino]benzoate;ethane (PubChem CID 142074214) has the molecular formula C24H30F3NO3 and a molecular weight of 437.50 g/mol. Its IUPAC name is benzyl 4-[hexyl-(2,2,2-trifluoroacetyl)amino]benzoate;ethane.
| Compound Name | benzyl 4-[hexyl-(2,2,2-trifluoroacetyl)amino]benzoate;ethane |
|---|---|
| PubChem CID | 142074214 |
| Molecular Formula | C24H30F3NO3 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | benzyl 4-[hexyl-(2,2,2-trifluoroacetyl)amino]benzoate;ethane |
| SMILES | CC.CCCCCCN(C(=O)C(F)(F)F)c1ccc(C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C22H24F3NO3.C2H6/c1-2-3-4-8-15-26(21(28)22(23,24)25)19-13-11-18(12-14-19)20(27)29-16-17-9-6-5-7-10-17;1-2/h5-7,9-14H,2-4,8,15-16H2,1H3;1-2H3 |
| InChIKey | FLFCKEASRQYTBE-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|