C35H46N2O8S — CID 123377917
benzyl (2R)-2-aminopropanoate;benzyl (2R)-2-[[(1R,2R)-2-ethylcyclopentanecarbonyl]amino]propanoate;4-methylbenzenesulfonic acid (PubChem CID 123377917) has the molecular formula C35H46N2O8S and a molecular weight of 654.83 g/mol. Its IUPAC name is benzyl (2R)-2-aminopropanoate;benzyl (2R)-2-[[(1R,2R)-2-ethylcyclopentanecarbonyl]amino]propanoate;4-methylbenzenesulfonic acid.
| Compound Name | benzyl (2R)-2-aminopropanoate;benzyl (2R)-2-[[(1R,2R)-2-ethylcyclopentanecarbonyl]amino]propanoate;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 123377917 |
| Molecular Formula | C35H46N2O8S |
| Molecular Weight | 654.83 g/mol |
| Exact Mass | 654.30 |
| IUPAC Name | benzyl (2R)-2-aminopropanoate;benzyl (2R)-2-[[(1R,2R)-2-ethylcyclopentanecarbonyl]amino]propanoate;4-methylbenzenesulfonic acid |
| SMILES | CC[C@@H]1CCC[C@H]1C(=O)N[C@H](C)C(=O)OCc1ccccc1.C[C@@H](N)C(=O)OCc1ccccc1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C18H25NO3.C10H13NO2.C7H8O3S/c1-3-15-10-7-11-16(15)17(20)19-13(2)18(21)22-12-14-8-5-4-6-9-14;1-8(11)10(12)13-7-9-5-3-2-4-6-9;1-6-2-4-7(5-3-6)11(8,9)10/h4-6,8-9,13,15-16H,3,7,10-12H2,1-2H3,(H,19,20);2-6,8H,7,11H2,1H3;2-5H,1H3,(H,8,9,10)/t13-,15-,16-;8-;/m11./s1 |
| InChIKey | SWZFMGWOOFGWDV-INQLDQTOSA-N |
| XLogP | 5.38 |
| TPSA | 162.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.83 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|