C19H22NO5S- — CID 22120947
benzyl 1-aminocyclobutane-1-carboxylate;4-methylbenzenesulfonate (PubChem CID 22120947) has the molecular formula C19H22NO5S- and a molecular weight of 376.45 g/mol. Its IUPAC name is benzyl 1-aminocyclobutane-1-carboxylate;4-methylbenzenesulfonate.
| Compound Name | benzyl 1-aminocyclobutane-1-carboxylate;4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 22120947 |
| Molecular Formula | C19H22NO5S- |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | benzyl 1-aminocyclobutane-1-carboxylate;4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)[O-])cc1.NC1(C(=O)OCc2ccccc2)CCC1 |
| InChI | InChI=1S/C12H15NO2.C7H8O3S/c13-12(7-4-8-12)11(14)15-9-10-5-2-1-3-6-10;1-6-2-4-7(5-3-6)11(8,9)10/h1-3,5-6H,4,7-9,13H2;2-5H,1H3,(H,8,9,10)/p-1 |
| InChIKey | VMURDJGCQYSKKE-UHFFFAOYSA-M |
| XLogP | 2.51 |
| TPSA | 109.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|