C17H25NO5S — CID 86720670
cyclopentyl 1-aminocyclobutane-1-carboxylate;4-methylbenzenesulfonic acid (PubChem CID 86720670) has the molecular formula C17H25NO5S and a molecular weight of 355.46 g/mol. Its IUPAC name is cyclopentyl 1-aminocyclobutane-1-carboxylate;4-methylbenzenesulfonic acid.
| Compound Name | cyclopentyl 1-aminocyclobutane-1-carboxylate;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 86720670 |
| Molecular Formula | C17H25NO5S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | cyclopentyl 1-aminocyclobutane-1-carboxylate;4-methylbenzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.NC1(C(=O)OC2CCCC2)CCC1 |
| InChI | InChI=1S/C10H17NO2.C7H8O3S/c11-10(6-3-7-10)9(12)13-8-4-1-2-5-8;1-6-2-4-7(5-3-6)11(8,9)10/h8H,1-7,11H2;2-5H,1H3,(H,8,9,10) |
| InChIKey | MOZTXKYIVTVXRV-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|