C12H17NO3S — CID 173060811
1-ethenylcyclopropan-1-amine;4-methylbenzenesulfonic acid (PubChem CID 173060811) has the molecular formula C12H17NO3S and a molecular weight of 255.34 g/mol. Its IUPAC name is 1-ethenylcyclopropan-1-amine;4-methylbenzenesulfonic acid.
| Compound Name | 1-ethenylcyclopropan-1-amine;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 173060811 |
| Molecular Formula | C12H17NO3S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 1-ethenylcyclopropan-1-amine;4-methylbenzenesulfonic acid |
| SMILES | C=CC1(N)CC1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C7H8O3S.C5H9N/c1-6-2-4-7(5-3-6)11(8,9)10;1-2-5(6)3-4-5/h2-5H,1H3,(H,8,9,10);2H,1,3-4,6H2 |
| InChIKey | URPKFWORYCGELF-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|